How to get the required json path? - json

Question

I had this type of JSON structure and I want to fetch the upper element in the hierarchy on applying condition on lower element in hierarchy
{
"name": "ninja",
"contry": "India",
"Account": [
{
"id": "123",
"orgId": 223,
"investment": [
{
"invetmentId": "111",
"name": "India tech",
"performance": [
{
"id": "123",
"performanceSet": [
{
"amount": "210",
"currency": "YEN"
},
{
"amount": "231",
"currency": "USD"
},
{
"amount": "233",
"currency": "USD"
},
{
"amount": "250",
"currency": "IND"
}
],
"loyal": "250"
}
]
},
{
"invetmentId": "111",
"name": "USA tech",
"performance": [
{
"id": "245",
"performanceSet": [
{
"amount": "956",
"currency": "ASD"
},
{
"amount": "231",
"currency": "USD"
},
{
"amount": "233",
"currency": "USD"
},
{
"amount": "250",
"currency": "IND"
}
],
"loyal": "250"
}
]
}
]
}
]
}
So what I need is I need the investment name for which performance.id = 123 i.e it should return "India tech".So I want to know if that can be possible or not if yes how can I get that?

Answer 1

This method doesn't use nested forEach which is O(n²) and it stops iterating once it finds the matched result
data = { name: "ninja", contry: "India", Account: [ { id: "123", orgId: 223, investment: [ { invetmentId: "111", name: "India tech", performance: [ { id: "123", performanceSet: [ { amount: "210", currency: "YEN", }, { amount: "231", currency: "USD", }, { amount: "233", currency: "USD", }, { amount: "250", currency: "IND", }, ], loyal: "250", }, ], }, { invetmentId: "111", name: "USA tech", performance: [ { id: "245", performanceSet: [ { amount: "956", currency: "ASD", }, { amount: "231", currency: "USD", }, { amount: "233", currency: "USD", }, { amount: "250", currency: "IND", }, ], loyal: "250", }, ], }, ], }, ], };
res = [];
finfperf = (id) => {
data.Account.forEach((inv) =>
res.push(
inv.investment.find((o) => o.performance.some((a) => a.id == id)).name
)
);
return res;
};
console.log(finfperf(123));
console.log(finfperf(245));